Naphthacènes
- (3)
- (1)
- (7)
- (1)
- (3)
- (1)
- (3)
- (1)
- (1)
- (1)
- (2)
- (2)
- (3)
- (3)
- (7)
- (3)
Résultats de la recherche filtrée
Poudre de fullerène, 97 % C{70}, Thermo Scientific Chemicals
CAS: 115383-22-7 Formule moléculaire: C70 Poids moléculaire (g/mol): 840.77 Numéro MDL: MFCD00282904 Clé InChI: ATLMFJTZZPOKLC-UHFFFAOYSA-N Synonyme: fullerene,fullerene 70,rugbyballene,carbon,70-d5h fullerene,buckminsterfullerene,5,6 fullerene-c70-d5h 6,c70-d5h 6 5,6 fullerene,fullerene powder, c 250mg CID PubChem: 16131935 ChEBI: CHEBI:33195 Nom IUPAC: (C\{70}-D\{5h(6)})[5,6]fullerène SMILES: C12=C3C4=C5C6=C7C8=C9C%10=C%11C%12=C%13C%10=C%10C8=C5C1=C%10C1=C%13C5=C8C1=C2C1=C3C2=C3C%10=C%13C%14=C3C1=C8C1=C3C5=C%12C5=C8C%11=C%11C9=C7C7=C9C6=C4C2=C2C%10=C4C(=C29)C2=C6C(=C8C8=C9C6=C4C%13=C9C(=C%141)C3=C85)C%11=C27
| Poids moléculaire (g/mol) | 840.77 |
|---|---|
| Synonyme | fullerene,fullerene 70,rugbyballene,carbon,70-d5h fullerene,buckminsterfullerene,5,6 fullerene-c70-d5h 6,c70-d5h 6 5,6 fullerene,fullerene powder, c 250mg |
| Numéro MDL | MFCD00282904 |
| CAS | 115383-22-7 |
| CID PubChem | 16131935 |
| ChEBI | CHEBI:33195 |
| Nom IUPAC | (C\{70}-D\{5h(6)})[5,6]fullerène |
| Clé InChI | ATLMFJTZZPOKLC-UHFFFAOYSA-N |
| SMILES | C12=C3C4=C5C6=C7C8=C9C%10=C%11C%12=C%13C%10=C%10C8=C5C1=C%10C1=C%13C5=C8C1=C2C1=C3C2=C3C%10=C%13C%14=C3C1=C8C1=C3C5=C%12C5=C8C%11=C%11C9=C7C7=C9C6=C4C2=C2C%10=C4C(=C29)C2=C6C(=C8C8=C9C6=C4C%13=C9C(=C%141)C3=C85)C%11=C27 |
| Formule moléculaire | C70 |
2,3-benzanthracène, 98 %, Thermo Scientific Chemicals
CAS: 92-24-0 Formule moléculaire: C18H12 Poids moléculaire (g/mol): 228.29 Clé InChI: IFLREYGFSNHWGE-UHFFFAOYSA-N Synonyme: naphthacene,2,3-benzanthracene,rubene,benz b anthracene,2,3-benzanthrene,chrysogen,hydrocarbon,unii-qyj5z6712r,ccris 1183 CID PubChem: 7080 ChEBI: CHEBI:32600 Nom IUPAC: tétracène SMILES: C1=CC=C2C=C3C=C4C=CC=CC4=CC3=CC2=C1
| Poids moléculaire (g/mol) | 228.29 |
|---|---|
| Synonyme | naphthacene,2,3-benzanthracene,rubene,benz b anthracene,2,3-benzanthrene,chrysogen,hydrocarbon,unii-qyj5z6712r,ccris 1183 |
| CAS | 92-24-0 |
| CID PubChem | 7080 |
| ChEBI | CHEBI:32600 |
| Nom IUPAC | tétracène |
| Clé InChI | IFLREYGFSNHWGE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C3C=C4C=CC=CC4=CC3=CC2=C1 |
| Formule moléculaire | C18H12 |
Poudre de fullerène, 98+ % C{70}, Thermo Scientific Chemicals
CAS: 115383-22-7 Formule moléculaire: C70 Poids moléculaire (g/mol): 840.77 Numéro MDL: MFCD00282904 Clé InChI: ATLMFJTZZPOKLC-UHFFFAOYSA-N Synonyme: fullerene,fullerene 70,rugbyballene,carbon,70-d5h fullerene,buckminsterfullerene,5,6 fullerene-c70-d5h 6,c70-d5h 6 5,6 fullerene,fullerene powder, c 250mg CID PubChem: 16131935 ChEBI: CHEBI:33195 Nom IUPAC: (C\{70}-D\{5h(6)})[5,6]fullerène SMILES: C12=C3C4=C5C6=C7C8=C9C%10=C%11C%12=C%13C%10=C%10C8=C5C1=C%10C1=C%13C5=C8C1=C2C1=C3C2=C3C%10=C%13C%14=C3C1=C8C1=C3C5=C%12C5=C8C%11=C%11C9=C7C7=C9C6=C4C2=C2C%10=C4C(=C29)C2=C6C(=C8C8=C9C6=C4C%13=C9C(=C%141)C3=C85)C%11=C27
| Poids moléculaire (g/mol) | 840.77 |
|---|---|
| Synonyme | fullerene,fullerene 70,rugbyballene,carbon,70-d5h fullerene,buckminsterfullerene,5,6 fullerene-c70-d5h 6,c70-d5h 6 5,6 fullerene,fullerene powder, c 250mg |
| Numéro MDL | MFCD00282904 |
| CAS | 115383-22-7 |
| CID PubChem | 16131935 |
| ChEBI | CHEBI:33195 |
| Nom IUPAC | (C\{70}-D\{5h(6)})[5,6]fullerène |
| Clé InChI | ATLMFJTZZPOKLC-UHFFFAOYSA-N |
| SMILES | C12=C3C4=C5C6=C7C8=C9C%10=C%11C%12=C%13C%10=C%10C8=C5C1=C%10C1=C%13C5=C8C1=C2C1=C3C2=C3C%10=C%13C%14=C3C1=C8C1=C3C5=C%12C5=C8C%11=C%11C9=C7C7=C9C6=C4C2=C2C%10=C4C(=C29)C2=C6C(=C8C8=C9C6=C4C%13=C9C(=C%141)C3=C85)C%11=C27 |
| Formule moléculaire | C70 |
Poudre de fullerène, 99+ % C{70}, Thermo Scientific Chemicals
CAS: 115383-22-7 Formule moléculaire: C70 Poids moléculaire (g/mol): 840.77 Numéro MDL: MFCD00282904 Clé InChI: ATLMFJTZZPOKLC-UHFFFAOYSA-N Synonyme: fullerene,fullerene 70,rugbyballene,carbon,70-d5h fullerene,buckminsterfullerene,5,6 fullerene-c70-d5h 6,c70-d5h 6 5,6 fullerene,fullerene powder, c 250mg CID PubChem: 16131935 ChEBI: CHEBI:33195 Nom IUPAC: (C\{70}-D\{5h(6)})[5,6]fullerène SMILES: C12=C3C4=C5C6=C7C8=C9C%10=C%11C%12=C%13C%10=C%10C8=C5C1=C%10C1=C%13C5=C8C1=C2C1=C3C2=C3C%10=C%13C%14=C3C1=C8C1=C3C5=C%12C5=C8C%11=C%11C9=C7C7=C9C6=C4C2=C2C%10=C4C(=C29)C2=C6C(=C8C8=C9C6=C4C%13=C9C(=C%141)C3=C85)C%11=C27
| Poids moléculaire (g/mol) | 840.77 |
|---|---|
| Synonyme | fullerene,fullerene 70,rugbyballene,carbon,70-d5h fullerene,buckminsterfullerene,5,6 fullerene-c70-d5h 6,c70-d5h 6 5,6 fullerene,fullerene powder, c 250mg |
| Numéro MDL | MFCD00282904 |
| CAS | 115383-22-7 |
| CID PubChem | 16131935 |
| ChEBI | CHEBI:33195 |
| Nom IUPAC | (C\{70}-D\{5h(6)})[5,6]fullerène |
| Clé InChI | ATLMFJTZZPOKLC-UHFFFAOYSA-N |
| SMILES | C12=C3C4=C5C6=C7C8=C9C%10=C%11C%12=C%13C%10=C%10C8=C5C1=C%10C1=C%13C5=C8C1=C2C1=C3C2=C3C%10=C%13C%14=C3C1=C8C1=C3C5=C%12C5=C8C%11=C%11C9=C7C7=C9C6=C4C2=C2C%10=C4C(=C29)C2=C6C(=C8C8=C9C6=C4C%13=C9C(=C%141)C3=C85)C%11=C27 |
| Formule moléculaire | C70 |
14-O-Acetyldaunomycinone, TRC
High-purity organic molecules and analytical standards, strategically delivered worldwide to empower innovation and commercial success.