Learn More
Glufosinate ammonium, 95%, Thermo Scientific™
Glufosinate ammonium, 95%, CAS # 77182-82-2, also known as glufosinate, is a non-selective phosphorous herbicide.
Marque: Thermo Scientific Alfa Aesar J66186.MD
| Quantité | 250mg |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
General Description
• Glufosinate ammonium is a compound which exhibits broad-spectrum herbicidal properties through inhibition of glutamine synthetase, which disrupts cell membranes
Application
• Glufosinate ammonium acts as a non-selective herbicide
Identifiants chimiques
| 77182-82-2 | |
| 198.16 | |
| ZBMRKNMTMPPMMK-UHFFFAOYNA-N | |
| 122130249 | |
| [NH4+].CP(O)(=O)CCC(N)C([O-])=O |
| C5H15N2O4P | |
| MFCD00055562,MFCD00211362 | |
| DL-Phosphinothricin; 2-Amino-4-(hydroxymethylphosphinyl)butyric acid ammonium salt | |
| ammonium 2-amino-4-[hydroxy(methyl)phosphoryl]butanoate |
Spécification
| Glufosinate ammonium | |
| White | |
| >110°C (230°F) | |
| MFCD00055562,MFCD00211362 | |
| 519°C | |
| DL-Phosphinothricin; 2-Amino-4-(hydroxymethylphosphinyl)butyric acid ammonium salt | |
| ZBMRKNMTMPPMMK-UHFFFAOYNA-N | |
| ammonium 2-amino-4-[hydroxy(methyl)phosphoryl]butanoate | |
| 122130249 | |
| 95% |
| 77182-82-2 | |
| 250mg | |
| C5H15N2O4P | |
| 8163399 | |
| 14,7339 | |
| Soluble in water | |
| [NH4+].CP(O)(=O)CCC(N)C([O-])=O | |
| 198.16 | |
| 198.16 |
Veuillez fournir vos retours sur le contenu du produit en remplissant le formulaire ci-dessous.