missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Chlorhydrate d’ester diméthylique d’acide L-glutamique, 99 %, pur, Thermo Scientific Chemicals
47.60€ - 156.00€
Identifiants chimiques
| CAS | 23150-65-4 |
|---|---|
| Formule moléculaire | C7H13ClNO4 |
| Poids moléculaire (g/mol) | 210.63 |
| Numéro MDL | MFCD00038879 |
| Clé InChI | BPHCSYSXOKTCMA-UHFFFAOYNA-N |
| Synonyme | l-glutamic acid dimethyl ester hydrochloride, h-glu ome-ome.hcl, dimethyl l-glutamate hydrochloride, s-dimethyl 2-aminopentanedioate hydrochloride, unii-185vc5x3pf, 1,5-dimethyl 2s-2-aminopentanedioate hydrochloride, h-glu ome-ome inverted exclamation mark currencyhcl, s-dimethyl 2-aminopentanedioate hcl, glutamic acid dimethyl ester hydrochloride, dimethyl glutamic acid hydrochloride |
| CID PubChem | 12917568 |
| Nom IUPAC | diméthyle (2S)-2-aminopentanéioate ; chlorhydrate |
| SMILES | [Cl].COC(=O)CCC(N)C(=O)OC |
| Code produit | Marque | Quantité | Prix | Quantité et disponibilité | |||||
|---|---|---|---|---|---|---|---|---|---|
| Code produit | Marque | Quantité | Prix | Quantité et disponibilité | |||||
|
11995381
|
Thermo Scientific Acros
441940100 |
10 g | |||||||
|
11925391
|
Thermo Scientific Acros
441940500 |
50 g |
156.00€
50g |
Veuillez vous connecter pour pouvoir commander cet article. Besoin d'un compte web? Créer le vôtre dès maintenant! | |||||
Description
This Thermo Scientific Chemicals brand product was originally part of the Acros Organics product portfolio. Some documentation and label information may refer to the legacy brand. The original Acros Organics product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Identifiants chimiques
| 23150-65-4 | |
| 210.63 | |
| BPHCSYSXOKTCMA-UHFFFAOYNA-N | |
| 12917568 | |
| [Cl].COC(=O)CCC(N)C(=O)OC |
| C7H13ClNO4 | |
| MFCD00038879 | |
| l-glutamic acid dimethyl ester hydrochloride, h-glu ome-ome.hcl, dimethyl l-glutamate hydrochloride, s-dimethyl 2-aminopentanedioate hydrochloride, unii-185vc5x3pf, 1,5-dimethyl 2s-2-aminopentanedioate hydrochloride, h-glu ome-ome inverted exclamation mark currencyhcl, s-dimethyl 2-aminopentanedioate hcl, glutamic acid dimethyl ester hydrochloride, dimethyl glutamic acid hydrochloride | |
| diméthyle (2S)-2-aminopentanéioate ; chlorhydrate |
Spécification
| L-Glutamic acid dimethyl ester hydrochloride | |
| 91°C to 93°C | |
| Authentique | |
| Flacon en verre | |
| MFCD00038879 | |
| l-glutamic acid dimethyl ester hydrochloride, h-glu ome-ome.hcl, dimethyl l-glutamate hydrochloride, s-dimethyl 2-aminopentanedioate hydrochloride, unii-185vc5x3pf, 1,5-dimethyl 2s-2-aminopentanedioate hydrochloride, h-glu ome-ome inverted exclamation mark currencyhcl, s-dimethyl 2-aminopentanedioate hcl, glutamic acid dimethyl ester hydrochloride, dimethyl glutamic acid hydrochloride | |
| [Cl].COC(=O)CCC(N)C(=O)OC | |
| 210.63 | |
| 211.65 | |
| Pures |
| 23150-65-4 | |
| Blanc | |
| 98.5% min. (Argentometry) | |
| C7H13ClNO4 | |
| 26 | |
| BPHCSYSXOKTCMA-UHFFFAOYNA-N | |
| diméthyle (2S)-2-aminopentanéioate ; chlorhydrate | |
| 12917568 | |
| 99% | |
| Poudre |
Sécurité et traitement
missing translation for 'einecsNumber' : 245-461-
Identifiant produit
- L-Glutamic acid dimethyl ester hydrochloride
RUO – Research Use Only