Learn More
Pirenzepine dihydrochloride, 99%, Thermo Scientific™
A M1 muscarinic receptor antagonist
Marque: Thermo Scientific Alfa Aesar J62252.MC
| Quantité | 100mg |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Identifiants chimiques
| 29868-97-1 | |
| 424.326 | |
| FFNMBRCFFADNAO-UHFFFAOYSA-N | |
| 71405 | |
| 11-[2-(4-methylpiperazin-1-yl)acetyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one;dihydrochloride |
| C19H23Cl2N5O2 | |
| MFCD00055214 | |
| pirenzepine dihydrochloride, pirenzepine hydrochloride, tabe, bisvanil, leblon, maghen, pirenzepine hcl, pirenzepine 2hcl, ls 519 dihydrochloride, unii-10ym403fls | |
| CHEBI:32014 | |
| CN1CCN(CC1)CC(=O)N2C3=CC=CC=C3C(=O)NC4=C2N=CC=C4.Cl.Cl |
Spécification
| Pirenzepine dihydrochloride | |
| C19H23Cl2N5O2 | |
| 100mg | |
| 14,7491 | |
| FFNMBRCFFADNAO-UHFFFAOYSA-N | |
| 11-[2-(4-methylpiperazin-1-yl)acetyl]-5H-pyrido[2,3-b][1,4]benzodiazepin-6-one;dihydrochloride | |
| 71405 | |
| 424.32 |
| 29868-97-1 | |
| MFCD00055214 | |
| Hygroscopic | |
| pirenzepine dihydrochloride, pirenzepine hydrochloride, tabe, bisvanil, leblon, maghen, pirenzepine hcl, pirenzepine 2hcl, ls 519 dihydrochloride, unii-10ym403fls | |
| CN1CCN(CC1)CC(=O)N2C3=CC=CC=C3C(=O)NC4=C2N=CC=C4.Cl.Cl | |
| 424.326 | |
| CHEBI:32014 | |
| 99% |
En cliquant sur Soumettre, vous reconnaissez que vous pouvez être contacté par Fisher Scientific au sujet des informations que vous avez fournies dans ce formulaire. Nous ne partagerons pas vos informations à d'autres fins. Toutes les informations de contact fournies seront également conservées conformément à notre politique de confidentialité. Politique de confidentialité.