Learn More
Quinapril hydrochloride, 98%, Thermo Scientific™
Angiotensin-converting enzyme inhibitor
Marque: Thermo Scientific Alfa Aesar J61913.06
| Quantité | 5g |
|---|
Description
This Thermo Scientific brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific.
Identifiants chimiques
| 82586-55-8 | |
| 474.982 | |
| IBBLRJGOOANPTQ-JKVLGAQCSA-N | |
| 54891 | |
| (3S)-2-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;hydrochloride |
| C25H31ClN2O5 | |
| MFCD00889215 | |
| quinapril hydrochloride, accupril, accuprin, acequin, quinazil, korec, quinapril hcl, lidaltrin, acuitel, ectren | |
| CHEBI:8714 | |
| CCOC(=O)C(CCC1=CC=CC=C1)NC(C)C(=O)N2CC3=CC=CC=C3CC2C(=O)O.Cl |
Spécification
| Quinapril hydrochloride | |
| C25H31ClN2O5 | |
| 5g | |
| quinapril hydrochloride, accupril, accuprin, acequin, quinazil, korec, quinapril hcl, lidaltrin, acuitel, ectren | |
| CCOC(=O)C(CCC1=CC=CC=C1)NC(C)C(=O)N2CC3=CC=CC=C3CC2C(=O)O.Cl | |
| 474.982 | |
| CHEBI:8714 | |
| 98% |
| 82586-55-8 | |
| MFCD00889215 | |
| 14,8051 | |
| IBBLRJGOOANPTQ-JKVLGAQCSA-N | |
| (3S)-2-[(2S)-2-[[(2S)-1-ethoxy-1-oxo-4-phenylbutan-2-yl]amino]propanoyl]-3,4-dihydro-1H-isoquinoline-3-carboxylic acid;hydrochloride | |
| 54891 | |
| 474.99 |
Veuillez fournir vos retours sur le contenu du produit en remplissant le formulaire ci-dessous.